About 1-O-ethyl 2-O-isocyanato benzene-1,2-dicarboxylate
1-O-ethyl 2-O-isocyanato benzene-1,2-dicarboxylate (PubChem CID 154191414) has the molecular formula C11H9NO5
and a molecular weight of 235.19 g/mol. Its IUPAC name is 1-O-ethyl 2-O-isocyanato benzene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-ethyl 2-O-isocyanato benzene-1,2-dicarboxylate |
| PubChem CID | 154191414 |
| Molecular Formula | C11H9NO5 |
| Molecular Weight | 235.19 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 1-O-ethyl 2-O-isocyanato benzene-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1ccccc1C(=O)ON=C=O |
| InChI | InChI=1S/C11H9NO5/c1-2-16-10(14)8-5-3-4-6-9(8)11(15)17-12-7-13/h3-6H,2H2,1H3 |
| InChIKey | CTXKMEFUVXXUGF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 2-O-isocyanato benzene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 2-O-isocyanato benzene-1,2-dicarboxylate?
The IUPAC name of 1-O-ethyl 2-O-isocyanato benzene-1,2-dicarboxylate (CID 154191414) is 1-O-ethyl 2-O-isocyanato benzene-1,2-dicarboxylate.
What is the SMILES notation for 1-O-ethyl 2-O-isocyanato benzene-1,2-dicarboxylate?
The canonical SMILES for 1-O-ethyl 2-O-isocyanato benzene-1,2-dicarboxylate is CCOC(=O)c1ccccc1C(=O)ON=C=O.
What is the InChIKey of 1-O-ethyl 2-O-isocyanato benzene-1,2-dicarboxylate?
The InChIKey is CTXKMEFUVXXUGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO5/c1-2-16-10(14)8-5-3-4-6-9(8)11(15)17-12-7-13/h3-6H,2H2,1H3.
What are the key properties of 1-O-ethyl 2-O-isocyanato benzene-1,2-dicarboxylate?
1-O-ethyl 2-O-isocyanato benzene-1,2-dicarboxylate has a molecular weight of 235.19 g/mol, XLogP of 1.27, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 2-O-isocyanato benzene-1,2-dicarboxylate is sourced from PubChem (CID 154191414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).