C10H17N — CID 154194625
3,7-dimethyloct-4-enenitrile (PubChem CID 154194625) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 3,7-dimethyloct-4-enenitrile.
| Compound Name | 3,7-dimethyloct-4-enenitrile |
|---|---|
| PubChem CID | 154194625 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 3,7-dimethyloct-4-enenitrile |
| SMILES | CC(C)CC=CC(C)CC#N |
| InChI | InChI=1S/C10H17N/c1-9(2)5-4-6-10(3)7-8-11/h4,6,9-10H,5,7H2,1-3H3 |
| InChIKey | KUPQLEBUPFDPDG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|