C10H19Br — CID 13192474
(E)-1-bromo-3,7-dimethyloct-4-ene (PubChem CID 13192474) has the molecular formula C10H19Br and a molecular weight of 219.17 g/mol. Its IUPAC name is (E)-1-bromo-3,7-dimethyloct-4-ene.
| Compound Name | (E)-1-bromo-3,7-dimethyloct-4-ene |
|---|---|
| PubChem CID | 13192474 |
| Molecular Formula | C10H19Br |
| Molecular Weight | 219.17 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | (E)-1-bromo-3,7-dimethyloct-4-ene |
| SMILES | CC(C)C/C=C/C(C)CCBr |
| InChI | InChI=1S/C10H19Br/c1-9(2)5-4-6-10(3)7-8-11/h4,6,9-10H,5,7-8H2,1-3H3/b6-4+ |
| InChIKey | HQBISFWKJSCLCW-GQCTYLIASA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.17 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|