C20H34O2 — CID 154197003
1-[2-(2-methoxyethyl)-6-methylcyclohexa-2,5-dien-1-yl]decan-1-one (PubChem CID 154197003) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 1-[2-(2-methoxyethyl)-6-methylcyclohexa-2,5-dien-1-yl]decan-1-one.
| Compound Name | 1-[2-(2-methoxyethyl)-6-methylcyclohexa-2,5-dien-1-yl]decan-1-one |
|---|---|
| PubChem CID | 154197003 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 1-[2-(2-methoxyethyl)-6-methylcyclohexa-2,5-dien-1-yl]decan-1-one |
| SMILES | CCCCCCCCCC(=O)C1C(C)=CCC=C1CCOC |
| InChI | InChI=1S/C20H34O2/c1-4-5-6-7-8-9-10-14-19(21)20-17(2)12-11-13-18(20)15-16-22-3/h12-13,20H,4-11,14-16H2,1-3H3 |
| InChIKey | UPWQIIBZCWYYBV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|