C11H15F3N4O2 — CID 154197926
tert-butyl 2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine-5-carboxylate (PubChem CID 154197926) has the molecular formula C11H15F3N4O2 and a molecular weight of 292.26 g/mol. Its IUPAC name is tert-butyl 2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine-5-carboxylate.
| Compound Name | tert-butyl 2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine-5-carboxylate |
|---|---|
| PubChem CID | 154197926 |
| Molecular Formula | C11H15F3N4O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | tert-butyl 2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CNCc2nc(C(F)(F)F)nn21 |
| InChI | InChI=1S/C11H15F3N4O2/c1-10(2,3)20-8(19)6-4-15-5-7-16-9(11(12,13)14)17-18(6)7/h6,15H,4-5H2,1-3H3 |
| InChIKey | PVVVTRCUZOXGCM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |