About 2-ethoxy-3-methoxyfuran
2-ethoxy-3-methoxyfuran (PubChem CID 154198368) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is 2-ethoxy-3-methoxyfuran.
Molecular Properties
| Compound Name | 2-ethoxy-3-methoxyfuran |
| PubChem CID | 154198368 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 2-ethoxy-3-methoxyfuran |
| SMILES | CCOc1occc1OC |
| InChI | InChI=1S/C7H10O3/c1-3-9-7-6(8-2)4-5-10-7/h4-5H,3H2,1-2H3 |
| InChIKey | SRPHVRWBIAQNKU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethoxy-3-methoxyfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3-methoxyfuran?
The IUPAC name of 2-ethoxy-3-methoxyfuran (CID 154198368) is 2-ethoxy-3-methoxyfuran.
What is the SMILES notation for 2-ethoxy-3-methoxyfuran?
The canonical SMILES for 2-ethoxy-3-methoxyfuran is CCOc1occc1OC.
What is the InChIKey of 2-ethoxy-3-methoxyfuran?
The InChIKey is SRPHVRWBIAQNKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-3-9-7-6(8-2)4-5-10-7/h4-5H,3H2,1-2H3.
What are the key properties of 2-ethoxy-3-methoxyfuran?
2-ethoxy-3-methoxyfuran has a molecular weight of 142.15 g/mol, XLogP of 1.69, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3-methoxyfuran is sourced from PubChem (CID 154198368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).