C8H17N5 — CID 154199516
4-[2-(dimethylamino)ethyl]-1H-pyrimidine-2,4-diamine (PubChem CID 154199516) has the molecular formula C8H17N5 and a molecular weight of 183.26 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethyl]-1H-pyrimidine-2,4-diamine.
| Compound Name | 4-[2-(dimethylamino)ethyl]-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 154199516 |
| Molecular Formula | C8H17N5 |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 183.15 |
| IUPAC Name | 4-[2-(dimethylamino)ethyl]-1H-pyrimidine-2,4-diamine |
| SMILES | CN(C)CCC1(N)C=CNC(N)=N1 |
| InChI | InChI=1S/C8H17N5/c1-13(2)6-4-8(10)3-5-11-7(9)12-8/h3,5H,4,6,10H2,1-2H3,(H3,9,11,12) |
| InChIKey | NQHJKSHMYSATFT-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |