C12H22O9 — CID 154199537
carboxy 6,6-diethoxyhexylperoxy carbonate (PubChem CID 154199537) has the molecular formula C12H22O9 and a molecular weight of 310.30 g/mol. Its IUPAC name is carboxy 6,6-diethoxyhexylperoxy carbonate.
| Compound Name | carboxy 6,6-diethoxyhexylperoxy carbonate |
|---|---|
| PubChem CID | 154199537 |
| Molecular Formula | C12H22O9 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | carboxy 6,6-diethoxyhexylperoxy carbonate |
| SMILES | CCOC(CCCCCOOOC(=O)OC(=O)O)OCC |
| InChI | InChI=1S/C12H22O9/c1-3-16-10(17-4-2)8-6-5-7-9-18-21-20-12(15)19-11(13)14/h10H,3-9H2,1-2H3,(H,13,14) |
| InChIKey | VPFZEYNQWKBZAH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|