C19H20O4 — CID 154203925
(7-methoxy-3-methyl-2-phenyl-3,4-dihydro-2H-chromen-6-yl) acetate (PubChem CID 154203925) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is (7-methoxy-3-methyl-2-phenyl-3,4-dihydro-2H-chromen-6-yl) acetate.
| Compound Name | (7-methoxy-3-methyl-2-phenyl-3,4-dihydro-2H-chromen-6-yl) acetate |
|---|---|
| PubChem CID | 154203925 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (7-methoxy-3-methyl-2-phenyl-3,4-dihydro-2H-chromen-6-yl) acetate |
| SMILES | COc1cc2c(cc1OC(C)=O)CC(C)C(c1ccccc1)O2 |
| InChI | InChI=1S/C19H20O4/c1-12-9-15-10-18(22-13(2)20)17(21-3)11-16(15)23-19(12)14-7-5-4-6-8-14/h4-8,10-12,19H,9H2,1-3H3 |
| InChIKey | AGBMBJCHTJGVOI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|