C21H20O7 — CID 162892908
[(2R,3S)-7-acetyloxy-2-(4-acetyloxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate (PubChem CID 162892908) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol. Its IUPAC name is [(2R,3S)-7-acetyloxy-2-(4-acetyloxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate.
| Compound Name | [(2R,3S)-7-acetyloxy-2-(4-acetyloxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate |
|---|---|
| PubChem CID | 162892908 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [(2R,3S)-7-acetyloxy-2-(4-acetyloxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate |
| SMILES | CC(=O)Oc1ccc([C@H]2Oc3cc(OC(C)=O)ccc3C[C@@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C21H20O7/c1-12(22)25-17-7-4-15(5-8-17)21-20(27-14(3)24)10-16-6-9-18(26-13(2)23)11-19(16)28-21/h4-9,11,20-21H,10H2,1-3H3/t20-,21+/m0/s1 |
| InChIKey | XTAYSFZADVNQKM-LEWJYISDSA-N |
| XLogP | 3.15 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|