C21H50N2O2Si2 — CID 154206629
N,N'-bis(3-methoxysilyl-3-methylbutyl)nonane-1,9-diamine (PubChem CID 154206629) has the molecular formula C21H50N2O2Si2 and a molecular weight of 418.82 g/mol. Its IUPAC name is N,N'-bis(3-methoxysilyl-3-methylbutyl)nonane-1,9-diamine.
| Compound Name | N,N'-bis(3-methoxysilyl-3-methylbutyl)nonane-1,9-diamine |
|---|---|
| PubChem CID | 154206629 |
| Molecular Formula | C21H50N2O2Si2 |
| Molecular Weight | 418.82 g/mol |
| Exact Mass | 418.34 |
| IUPAC Name | N,N'-bis(3-methoxysilyl-3-methylbutyl)nonane-1,9-diamine |
| SMILES | CO[SiH2]C(C)(C)CCNCCCCCCCCCNCCC(C)(C)[SiH2]OC |
| InChI | InChI=1S/C21H50N2O2Si2/c1-20(2,26-24-5)14-18-22-16-12-10-8-7-9-11-13-17-23-19-15-21(3,4)27-25-6/h22-23H,7-19,26-27H2,1-6H3 |
| InChIKey | FZRHTYIGQYHZFV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.82 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|