C15H16O10 — CID 15420875
dimethyl 2,6-bis(acetyloxymethyl)-4-oxopyran-3,5-dicarboxylate (PubChem CID 15420875) has the molecular formula C15H16O10 and a molecular weight of 356.28 g/mol. Its IUPAC name is dimethyl 2,6-bis(acetyloxymethyl)-4-oxopyran-3,5-dicarboxylate.
| Compound Name | dimethyl 2,6-bis(acetyloxymethyl)-4-oxopyran-3,5-dicarboxylate |
|---|---|
| PubChem CID | 15420875 |
| Molecular Formula | C15H16O10 |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | dimethyl 2,6-bis(acetyloxymethyl)-4-oxopyran-3,5-dicarboxylate |
| SMILES | COC(=O)c1c(COC(C)=O)oc(COC(C)=O)c(C(=O)OC)c1=O |
| InChI | InChI=1S/C15H16O10/c1-7(16)23-5-9-11(14(19)21-3)13(18)12(15(20)22-4)10(25-9)6-24-8(2)17/h5-6H2,1-4H3 |
| InChIKey | RXHIHBYHROKPTK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 135.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|