C15H18O8 — CID 15420878
diethyl 2-(acetyloxymethyl)-6-methyl-4-oxopyran-3,5-dicarboxylate (PubChem CID 15420878) has the molecular formula C15H18O8 and a molecular weight of 326.30 g/mol. Its IUPAC name is diethyl 2-(acetyloxymethyl)-6-methyl-4-oxopyran-3,5-dicarboxylate.
| Compound Name | diethyl 2-(acetyloxymethyl)-6-methyl-4-oxopyran-3,5-dicarboxylate |
|---|---|
| PubChem CID | 15420878 |
| Molecular Formula | C15H18O8 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | diethyl 2-(acetyloxymethyl)-6-methyl-4-oxopyran-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)oc(COC(C)=O)c(C(=O)OCC)c1=O |
| InChI | InChI=1S/C15H18O8/c1-5-20-14(18)11-8(3)23-10(7-22-9(4)16)12(13(11)17)15(19)21-6-2/h5-7H2,1-4H3 |
| InChIKey | BHGIVAZUQNUENL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|