C11H9Cl3N4O4 — CID 15422050
5-hydroxy-3-(4-nitrophenyl)-5-(trichloromethyl)-4H-pyrazole-1-carboxamide (PubChem CID 15422050) has the molecular formula C11H9Cl3N4O4 and a molecular weight of 367.58 g/mol. Its IUPAC name is 5-hydroxy-3-(4-nitrophenyl)-5-(trichloromethyl)-4H-pyrazole-1-carboxamide.
| Compound Name | 5-hydroxy-3-(4-nitrophenyl)-5-(trichloromethyl)-4H-pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 15422050 |
| Molecular Formula | C11H9Cl3N4O4 |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | 5-hydroxy-3-(4-nitrophenyl)-5-(trichloromethyl)-4H-pyrazole-1-carboxamide |
| SMILES | NC(=O)N1N=C(c2ccc([N+](=O)[O-])cc2)CC1(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H9Cl3N4O4/c12-11(13,14)10(20)5-8(16-17(10)9(15)19)6-1-3-7(4-2-6)18(21)22/h1-4,20H,5H2,(H2,15,19) |
| InChIKey | GSDMXKHJZKXPMP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|