C21H14N2O5 — CID 154221803
3-[[4-[2-(2-hydroxy-3,4-dioxocyclobuten-1-yl)phenyl]phenyl]methyl]imidazole-4-carboxylic acid (PubChem CID 154221803) has the molecular formula C21H14N2O5 and a molecular weight of 374.35 g/mol. Its IUPAC name is 3-[[4-[2-(2-hydroxy-3,4-dioxocyclobuten-1-yl)phenyl]phenyl]methyl]imidazole-4-carboxylic acid.
| Compound Name | 3-[[4-[2-(2-hydroxy-3,4-dioxocyclobuten-1-yl)phenyl]phenyl]methyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 154221803 |
| Molecular Formula | C21H14N2O5 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 3-[[4-[2-(2-hydroxy-3,4-dioxocyclobuten-1-yl)phenyl]phenyl]methyl]imidazole-4-carboxylic acid |
| SMILES | O=C(O)c1cncn1Cc1ccc(-c2ccccc2-c2c(O)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C21H14N2O5/c24-18-17(19(25)20(18)26)15-4-2-1-3-14(15)13-7-5-12(6-8-13)10-23-11-22-9-16(23)21(27)28/h1-9,11,24H,10H2,(H,27,28) |
| InChIKey | JYNPTUIZNJGEOS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|