C19H27F3N2 — CID 154227419
2-(2-methylpropyl)-N-[[2-(trifluoromethyl)phenyl]methyl]-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 154227419) has the molecular formula C19H27F3N2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 2-(2-methylpropyl)-N-[[2-(trifluoromethyl)phenyl]methyl]-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | 2-(2-methylpropyl)-N-[[2-(trifluoromethyl)phenyl]methyl]-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 154227419 |
| Molecular Formula | C19H27F3N2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 2-(2-methylpropyl)-N-[[2-(trifluoromethyl)phenyl]methyl]-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | CC(C)CC1C(NCc2ccccc2C(F)(F)F)C2CCN1CC2 |
| InChI | InChI=1S/C19H27F3N2/c1-13(2)11-17-18(14-7-9-24(17)10-8-14)23-12-15-5-3-4-6-16(15)19(20,21)22/h3-6,13-14,17-18,23H,7-12H2,1-2H3 |
| InChIKey | RMBCNGPTCIBZHI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |