C21H25IN2 — CID 155569480
(2R,3R)-2-benzyl-N-[(2-iodophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 155569480) has the molecular formula C21H25IN2 and a molecular weight of 432.35 g/mol. Its IUPAC name is (2R,3R)-2-benzyl-N-[(2-iodophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | (2R,3R)-2-benzyl-N-[(2-iodophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 155569480 |
| Molecular Formula | C21H25IN2 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | (2R,3R)-2-benzyl-N-[(2-iodophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | Ic1ccccc1CN[C@@H]1C2CCN(CC2)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C21H25IN2/c22-19-9-5-4-8-18(19)15-23-21-17-10-12-24(13-11-17)20(21)14-16-6-2-1-3-7-16/h1-9,17,20-21,23H,10-15H2/t20-,21-/m1/s1 |
| InChIKey | FOEGAUZKCUTCKY-NHCUHLMSSA-N |
| XLogP | 4.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|