C31H24F3N3O4S — CID 154228424
4-[hydroxy-(4-propan-2-ylphenyl)methylidene]-1-(6-phenylsulfanylpyridazin-3-yl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione (PubChem CID 154228424) has the molecular formula C31H24F3N3O4S and a molecular weight of 591.61 g/mol. Its IUPAC name is 4-[hydroxy-(4-propan-2-ylphenyl)methylidene]-1-(6-phenylsulfanylpyridazin-3-yl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy-(4-propan-2-ylphenyl)methylidene]-1-(6-phenylsulfanylpyridazin-3-yl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 154228424 |
| Molecular Formula | C31H24F3N3O4S |
| Molecular Weight | 591.61 g/mol |
| Exact Mass | 591.14 |
| IUPAC Name | 4-[hydroxy-(4-propan-2-ylphenyl)methylidene]-1-(6-phenylsulfanylpyridazin-3-yl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
| SMILES | CC(C)c1ccc(C(O)=C2C(=O)C(=O)N(c3ccc(Sc4ccccc4)nn3)C2c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C31H24F3N3O4S/c1-18(2)19-8-10-21(11-9-19)28(38)26-27(20-12-14-22(15-13-20)41-31(32,33)34)37(30(40)29(26)39)24-16-17-25(36-35-24)42-23-6-4-3-5-7-23/h3-18,27,38H,1-2H3 |
| InChIKey | BXRSSYVGMXWZIV-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.61 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|