C26H19F3N6O4 — CID 66854177
4-[hydroxy-[4-(trifluoromethoxy)phenyl]methylidene]-1-(6-methylpyridazin-3-yl)-5-[4-(1,2,4-triazol-1-ylmethyl)phenyl]pyrrolidine-2,3-dione (PubChem CID 66854177) has the molecular formula C26H19F3N6O4 and a molecular weight of 536.47 g/mol. Its IUPAC name is 4-[hydroxy-[4-(trifluoromethoxy)phenyl]methylidene]-1-(6-methylpyridazin-3-yl)-5-[4-(1,2,4-triazol-1-ylmethyl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy-[4-(trifluoromethoxy)phenyl]methylidene]-1-(6-methylpyridazin-3-yl)-5-[4-(1,2,4-triazol-1-ylmethyl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 66854177 |
| Molecular Formula | C26H19F3N6O4 |
| Molecular Weight | 536.47 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 4-[hydroxy-[4-(trifluoromethoxy)phenyl]methylidene]-1-(6-methylpyridazin-3-yl)-5-[4-(1,2,4-triazol-1-ylmethyl)phenyl]pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(N2C(=O)C(=O)C(=C(O)c3ccc(OC(F)(F)F)cc3)C2c2ccc(Cn3cncn3)cc2)nn1 |
| InChI | InChI=1S/C26H19F3N6O4/c1-15-2-11-20(33-32-15)35-22(17-5-3-16(4-6-17)12-34-14-30-13-31-34)21(24(37)25(35)38)23(36)18-7-9-19(10-8-18)39-26(27,28)29/h2-11,13-14,22,36H,12H2,1H3 |
| InChIKey | AHJUDAWECHTIEV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|