C25H22FN3O5 — CID 154231043
1-ethyl-3-[(3R)-1-[2-fluoro-5-[(3-oxo-2-benzofuran-1-ylidene)methyl]benzoyl]pyrrolidin-3-yl]imidazolidine-2,4-dione (PubChem CID 154231043) has the molecular formula C25H22FN3O5 and a molecular weight of 463.47 g/mol. Its IUPAC name is 1-ethyl-3-[(3R)-1-[2-fluoro-5-[(3-oxo-2-benzofuran-1-ylidene)methyl]benzoyl]pyrrolidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | 1-ethyl-3-[(3R)-1-[2-fluoro-5-[(3-oxo-2-benzofuran-1-ylidene)methyl]benzoyl]pyrrolidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154231043 |
| Molecular Formula | C25H22FN3O5 |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 1-ethyl-3-[(3R)-1-[2-fluoro-5-[(3-oxo-2-benzofuran-1-ylidene)methyl]benzoyl]pyrrolidin-3-yl]imidazolidine-2,4-dione |
| SMILES | CCN1CC(=O)N([C@@H]2CCN(C(=O)c3cc(C=C4OC(=O)c5ccccc54)ccc3F)C2)C1=O |
| InChI | InChI=1S/C25H22FN3O5/c1-2-27-14-22(30)29(25(27)33)16-9-10-28(13-16)23(31)19-11-15(7-8-20(19)26)12-21-17-5-3-4-6-18(17)24(32)34-21/h3-8,11-12,16H,2,9-10,13-14H2,1H3/t16-/m1/s1 |
| InChIKey | COAQVLDCQQJJAL-MRXNPFEDSA-N |
| XLogP | 2.99 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|