C16H18FN3O3 — CID 141450745
1-ethyl-3-[(3R)-1-(2-fluorobenzoyl)pyrrolidin-3-yl]imidazolidine-2,4-dione (PubChem CID 141450745) has the molecular formula C16H18FN3O3 and a molecular weight of 319.34 g/mol. Its IUPAC name is 1-ethyl-3-[(3R)-1-(2-fluorobenzoyl)pyrrolidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | 1-ethyl-3-[(3R)-1-(2-fluorobenzoyl)pyrrolidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 141450745 |
| Molecular Formula | C16H18FN3O3 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 1-ethyl-3-[(3R)-1-(2-fluorobenzoyl)pyrrolidin-3-yl]imidazolidine-2,4-dione |
| SMILES | CCN1CC(=O)N([C@@H]2CCN(C(=O)c3ccccc3F)C2)C1=O |
| InChI | InChI=1S/C16H18FN3O3/c1-2-18-10-14(21)20(16(18)23)11-7-8-19(9-11)15(22)12-5-3-4-6-13(12)17/h3-6,11H,2,7-10H2,1H3/t11-/m1/s1 |
| InChIKey | PAFQGHXVDOSYRV-LLVKDONJSA-N |
| XLogP | 1.32 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|