C14H14Cl2IN3O2 — CID 154239603
4-chloro-2-(2-chlorobutyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one (PubChem CID 154239603) has the molecular formula C14H14Cl2IN3O2 and a molecular weight of 454.10 g/mol. Its IUPAC name is 4-chloro-2-(2-chlorobutyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one.
| Compound Name | 4-chloro-2-(2-chlorobutyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one |
|---|---|
| PubChem CID | 154239603 |
| Molecular Formula | C14H14Cl2IN3O2 |
| Molecular Weight | 454.10 g/mol |
| Exact Mass | 452.95 |
| IUPAC Name | 4-chloro-2-(2-chlorobutyl)-5-[(6-iodo-3-pyridinyl)methoxy]pyridazin-3-one |
| SMILES | CCC(Cl)Cn1ncc(OCc2ccc(I)nc2)c(Cl)c1=O |
| InChI | InChI=1S/C14H14Cl2IN3O2/c1-2-10(15)7-20-14(21)13(16)11(6-19-20)22-8-9-3-4-12(17)18-5-9/h3-6,10H,2,7-8H2,1H3 |
| InChIKey | KIPBHBPWUGCNIJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.10 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|