C20H21NO6 — CID 154242505
ethyl 5-[(2-methoxybenzoyl)amino]-2-(oxiran-2-ylmethoxy)benzoate (PubChem CID 154242505) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is ethyl 5-[(2-methoxybenzoyl)amino]-2-(oxiran-2-ylmethoxy)benzoate.
| Compound Name | ethyl 5-[(2-methoxybenzoyl)amino]-2-(oxiran-2-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 154242505 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | ethyl 5-[(2-methoxybenzoyl)amino]-2-(oxiran-2-ylmethoxy)benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)c2ccccc2OC)ccc1OCC1CO1 |
| InChI | InChI=1S/C20H21NO6/c1-3-25-20(23)16-10-13(8-9-18(16)27-12-14-11-26-14)21-19(22)15-6-4-5-7-17(15)24-2/h4-10,14H,3,11-12H2,1-2H3,(H,21,22) |
| InChIKey | GEQORLOEZSDDND-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|