C10H13NO4 — CID 154243142
methyl 4-ethyl-1-nitrocyclohexa-2,4-diene-1-carboxylate (PubChem CID 154243142) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is methyl 4-ethyl-1-nitrocyclohexa-2,4-diene-1-carboxylate.
| Compound Name | methyl 4-ethyl-1-nitrocyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 154243142 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | methyl 4-ethyl-1-nitrocyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCC1=CCC(C(=O)OC)([N+](=O)[O-])C=C1 |
| InChI | InChI=1S/C10H13NO4/c1-3-8-4-6-10(7-5-8,11(13)14)9(12)15-2/h4-6H,3,7H2,1-2H3 |
| InChIKey | YXIUFDAXOROJFO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|