C49H43N3S2 — CID 15425024
N-(2-tritylsulfanylethyl)-1-[6-(2-tritylsulfanylethyliminomethyl)-2-pyridinyl]methanimine (PubChem CID 15425024) has the molecular formula C49H43N3S2 and a molecular weight of 738.04 g/mol. Its IUPAC name is N-(2-tritylsulfanylethyl)-1-[6-(2-tritylsulfanylethyliminomethyl)-2-pyridinyl]methanimine.
| Compound Name | N-(2-tritylsulfanylethyl)-1-[6-(2-tritylsulfanylethyliminomethyl)-2-pyridinyl]methanimine |
|---|---|
| PubChem CID | 15425024 |
| Molecular Formula | C49H43N3S2 |
| Molecular Weight | 738.04 g/mol |
| Exact Mass | 737.29 |
| IUPAC Name | N-(2-tritylsulfanylethyl)-1-[6-(2-tritylsulfanylethyliminomethyl)-2-pyridinyl]methanimine |
| SMILES | C(=N/CCSC(c1ccccc1)(c1ccccc1)c1ccccc1)\c1cccc(/C=N/CCSC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C49H43N3S2/c1-7-20-40(21-8-1)48(41-22-9-2-10-23-41,42-24-11-3-12-25-42)53-36-34-50-38-46-32-19-33-47(52-46)39-51-35-37-54-49(43-26-13-4-14-27-43,44-28-15-5-16-29-44)45-30-17-6-18-31-45/h1-33,38-39H,34-37H2/b50-38+,51-39+ |
| InChIKey | LWFMFMYQADAVOC-BYQQLPCHSA-N |
| XLogP | 11.37 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.04 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|