C17H20N4O2 — CID 102215916
[6-[3-[[6-(hydroxymethyl)-2-pyridinyl]methylideneamino]propyliminomethyl]-2-pyridinyl]methanol (PubChem CID 102215916) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is [6-[3-[[6-(hydroxymethyl)-2-pyridinyl]methylideneamino]propyliminomethyl]-2-pyridinyl]methanol.
| Compound Name | [6-[3-[[6-(hydroxymethyl)-2-pyridinyl]methylideneamino]propyliminomethyl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 102215916 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | [6-[3-[[6-(hydroxymethyl)-2-pyridinyl]methylideneamino]propyliminomethyl]-2-pyridinyl]methanol |
| SMILES | OCc1cccc(/C=N/CCC/N=C/c2cccc(CO)n2)n1 |
| InChI | InChI=1S/C17H20N4O2/c22-12-16-6-1-4-14(20-16)10-18-8-3-9-19-11-15-5-2-7-17(13-23)21-15/h1-2,4-7,10-11,22-23H,3,8-9,12-13H2/b18-10+,19-11+ |
| InChIKey | WNNLFXJKPXFBPM-XOBNHNQQSA-N |
| XLogP | 1.39 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|