C26H22CoN8O4 — CID 139144201
cobalt(2+);bis((NE,3Z)-N-[[6-(hydroxymethyl)-2-pyridinyl]methylidene]pyridine-3-carbohydrazonate) (PubChem CID 139144201) has the molecular formula C26H22CoN8O4 and a molecular weight of 569.45 g/mol. Its IUPAC name is cobalt(2+);bis((NE,3Z)-N-[[6-(hydroxymethyl)-2-pyridinyl]methylidene]pyridine-3-carbohydrazonate).
| Compound Name | cobalt(2+);bis((NE,3Z)-N-[[6-(hydroxymethyl)-2-pyridinyl]methylidene]pyridine-3-carbohydrazonate) |
|---|---|
| PubChem CID | 139144201 |
| Molecular Formula | C26H22CoN8O4 |
| Molecular Weight | 569.45 g/mol |
| Exact Mass | 569.11 |
| IUPAC Name | cobalt(2+);bis((NE,3Z)-N-[[6-(hydroxymethyl)-2-pyridinyl]methylidene]pyridine-3-carbohydrazonate) |
| SMILES | [Co+2].[O-]/C(=N\N=C/c1cccc(CO)n1)c1cccnc1.[O-]/C(=N\N=C\c1cccc(CO)n1)c1cccnc1 |
| InChI | InChI=1S/2C13H12N4O2.Co/c2*18-9-12-5-1-4-11(16-12)8-15-17-13(19)10-3-2-6-14-7-10;/h2*1-8,18H,9H2,(H,17,19);/q;;+2/p-2/b15-8+;15-8-; |
| InChIKey | WYVOTKAAGSWOMF-ZLWDZYPBSA-L |
| XLogP | 0.22 |
| TPSA | 187.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.45 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|