C14H13N3O5V — CID 74763337
(NE,3Z)-N-[(5-methoxy-2-oxidophenyl)methylidene]pyridine-3-carbohydrazonate;vanadium(4+);dihydroxide (PubChem CID 74763337) has the molecular formula C14H13N3O5V and a molecular weight of 354.22 g/mol. Its IUPAC name is (NE,3Z)-N-[(5-methoxy-2-oxidophenyl)methylidene]pyridine-3-carbohydrazonate;vanadium(4+);dihydroxide.
| Compound Name | (NE,3Z)-N-[(5-methoxy-2-oxidophenyl)methylidene]pyridine-3-carbohydrazonate;vanadium(4+);dihydroxide |
|---|---|
| PubChem CID | 74763337 |
| Molecular Formula | C14H13N3O5V |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | (NE,3Z)-N-[(5-methoxy-2-oxidophenyl)methylidene]pyridine-3-carbohydrazonate;vanadium(4+);dihydroxide |
| SMILES | COc1ccc([O-])c(/C=N/N=C(\[O-])c2cccnc2)c1.[OH-].[OH-].[V+4] |
| InChI | InChI=1S/C14H13N3O3.2H2O.V/c1-20-12-4-5-13(18)11(7-12)9-16-17-14(19)10-3-2-6-15-8-10;;;/h2-9,18H,1H3,(H,17,19);2*1H2;/q;;;+4/p-4/b16-9+;;; |
| InChIKey | HPVVCKUGWXYUDY-FCVRRRHYSA-J |
| XLogP | -0.05 |
| TPSA | 152.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|