C15H12N5O2- — CID 7608921
4-methoxy-2-[[3-(2H-tetrazol-5-yl)phenyl]iminomethyl]phenolate (PubChem CID 7608921) has the molecular formula C15H12N5O2- and a molecular weight of 294.29 g/mol. Its IUPAC name is 4-methoxy-2-[[3-(2H-tetrazol-5-yl)phenyl]iminomethyl]phenolate.
| Compound Name | 4-methoxy-2-[[3-(2H-tetrazol-5-yl)phenyl]iminomethyl]phenolate |
|---|---|
| PubChem CID | 7608921 |
| Molecular Formula | C15H12N5O2- |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-methoxy-2-[[3-(2H-tetrazol-5-yl)phenyl]iminomethyl]phenolate |
| SMILES | COc1ccc([O-])c(/C=N/c2cccc(-c3nn[nH]n3)c2)c1 |
| InChI | InChI=1S/C15H13N5O2/c1-22-13-5-6-14(21)11(8-13)9-16-12-4-2-3-10(7-12)15-17-19-20-18-15/h2-9,21H,1H3,(H,17,18,19,20)/p-1/b16-9+ |
| InChIKey | HZTKJKYJYVQSFI-CXUHLZMHSA-M |
| XLogP | 1.70 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|