About 1-diazoethylcyclohexane
1-diazoethylcyclohexane (PubChem CID 154252964) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 1-diazoethylcyclohexane.
Molecular Properties
| Compound Name | 1-diazoethylcyclohexane |
| PubChem CID | 154252964 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 1-diazoethylcyclohexane |
| SMILES | CC(=[N+]=[N-])C1CCCCC1 |
| InChI | InChI=1S/C8H14N2/c1-7(10-9)8-5-3-2-4-6-8/h8H,2-6H2,1H3 |
| InChIKey | ICQKGYJISHEHNA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-diazoethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diazoethylcyclohexane?
The IUPAC name of 1-diazoethylcyclohexane (CID 154252964) is 1-diazoethylcyclohexane.
What is the SMILES notation for 1-diazoethylcyclohexane?
The canonical SMILES for 1-diazoethylcyclohexane is CC(=[N+]=[N-])C1CCCCC1.
What is the InChIKey of 1-diazoethylcyclohexane?
The InChIKey is ICQKGYJISHEHNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-7(10-9)8-5-3-2-4-6-8/h8H,2-6H2,1H3.
What are the key properties of 1-diazoethylcyclohexane?
1-diazoethylcyclohexane has a molecular weight of 138.21 g/mol, XLogP of 2.26, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diazoethylcyclohexane is sourced from PubChem (CID 154252964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).