C23H30N2O4 — CID 154253182
benzyl N-[1-(4-hydroxyphenyl)-3-oxo-6-(propylamino)hexan-2-yl]carbamate (PubChem CID 154253182) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is benzyl N-[1-(4-hydroxyphenyl)-3-oxo-6-(propylamino)hexan-2-yl]carbamate.
| Compound Name | benzyl N-[1-(4-hydroxyphenyl)-3-oxo-6-(propylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 154253182 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | benzyl N-[1-(4-hydroxyphenyl)-3-oxo-6-(propylamino)hexan-2-yl]carbamate |
| SMILES | CCCNCCCC(=O)C(Cc1ccc(O)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H30N2O4/c1-2-14-24-15-6-9-22(27)21(16-18-10-12-20(26)13-11-18)25-23(28)29-17-19-7-4-3-5-8-19/h3-5,7-8,10-13,21,24,26H,2,6,9,14-17H2,1H3,(H,25,28) |
| InChIKey | JUMKCJULVLUWNT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|