C11H12F3NO5S — CID 154256551
2,2-dihydroxy-4-[3-(trifluoromethyl)phenyl]sulfonylbutanamide (PubChem CID 154256551) has the molecular formula C11H12F3NO5S and a molecular weight of 327.28 g/mol. Its IUPAC name is 2,2-dihydroxy-4-[3-(trifluoromethyl)phenyl]sulfonylbutanamide.
| Compound Name | 2,2-dihydroxy-4-[3-(trifluoromethyl)phenyl]sulfonylbutanamide |
|---|---|
| PubChem CID | 154256551 |
| Molecular Formula | C11H12F3NO5S |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 2,2-dihydroxy-4-[3-(trifluoromethyl)phenyl]sulfonylbutanamide |
| SMILES | NC(=O)C(O)(O)CCS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F3NO5S/c12-11(13,14)7-2-1-3-8(6-7)21(19,20)5-4-10(17,18)9(15)16/h1-3,6,17-18H,4-5H2,(H2,15,16) |
| InChIKey | AWQBTBMLWZIXGC-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|