C19H21NO3Si — CID 154260649
ethyl (2S)-1-benzhydrylsilyl-4-oxoazetidine-2-carboxylate (PubChem CID 154260649) has the molecular formula C19H21NO3Si and a molecular weight of 339.47 g/mol. Its IUPAC name is ethyl (2S)-1-benzhydrylsilyl-4-oxoazetidine-2-carboxylate.
| Compound Name | ethyl (2S)-1-benzhydrylsilyl-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 154260649 |
| Molecular Formula | C19H21NO3Si |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | ethyl (2S)-1-benzhydrylsilyl-4-oxoazetidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC(=O)N1[SiH2]C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H21NO3Si/c1-2-23-19(22)16-13-17(21)20(16)24-18(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16,18H,2,13,24H2,1H3/t16-/m0/s1 |
| InChIKey | TZXJDPSNXYKZIM-INIZCTEOSA-N |
| XLogP | 2.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|