C9H19NO3S — CID 154261171
3-(hex-5-enylazaniumyl)propane-1-sulfonate (PubChem CID 154261171) has the molecular formula C9H19NO3S and a molecular weight of 221.32 g/mol. Its IUPAC name is 3-(hex-5-enylazaniumyl)propane-1-sulfonate.
| Compound Name | 3-(hex-5-enylazaniumyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 154261171 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 3-(hex-5-enylazaniumyl)propane-1-sulfonate |
| SMILES | C=CCCCC[NH2+]CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H19NO3S/c1-2-3-4-5-7-10-8-6-9-14(11,12)13/h2,10H,1,3-9H2,(H,11,12,13) |
| InChIKey | BSEOWEUHPGVVLU-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|