C17H19NO5 — CID 154266934
5-hexyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid (PubChem CID 154266934) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is 5-hexyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid.
| Compound Name | 5-hexyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 154266934 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 5-hexyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
| SMILES | CCCCCCn1cc(C(=O)O)c(=O)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C17H19NO5/c1-2-3-4-5-6-18-9-12(17(20)21)16(19)11-7-14-15(8-13(11)18)23-10-22-14/h7-9H,2-6,10H2,1H3,(H,20,21) |
| InChIKey | ONMDIVWKTHYGMC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|