C20H28O3 — CID 154270567
(8S,9S,10R,11S,13S,14S)-11-hydroxy-8,10,13-trimethyl-1,2,6,7,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 154270567) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (8S,9S,10R,11S,13S,14S)-11-hydroxy-8,10,13-trimethyl-1,2,6,7,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8S,9S,10R,11S,13S,14S)-11-hydroxy-8,10,13-trimethyl-1,2,6,7,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 154270567 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (8S,9S,10R,11S,13S,14S)-11-hydroxy-8,10,13-trimethyl-1,2,6,7,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@@]12CCC3=CC(=O)CC[C@]3(C)[C@H]1[C@@H](O)C[C@]1(C)C(=O)CC[C@@H]21 |
| InChI | InChI=1S/C20H28O3/c1-18-9-7-13(21)10-12(18)6-8-19(2)15-4-5-16(23)20(15,3)11-14(22)17(18)19/h10,14-15,17,22H,4-9,11H2,1-3H3/t14-,15-,17+,18-,19-,20-/m0/s1 |
| InChIKey | NCRVHVJMTACUNJ-GECNCUIPSA-N |
| XLogP | 3.45 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |