C17H13ClF3N3O — CID 154271099
2-[(1S)-1-(6-chloro-1H-benzimidazol-2-yl)ethyl]-3-(trifluoromethyl)benzamide (PubChem CID 154271099) has the molecular formula C17H13ClF3N3O and a molecular weight of 367.76 g/mol. Its IUPAC name is 2-[(1S)-1-(6-chloro-1H-benzimidazol-2-yl)ethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 2-[(1S)-1-(6-chloro-1H-benzimidazol-2-yl)ethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 154271099 |
| Molecular Formula | C17H13ClF3N3O |
| Molecular Weight | 367.76 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 2-[(1S)-1-(6-chloro-1H-benzimidazol-2-yl)ethyl]-3-(trifluoromethyl)benzamide |
| SMILES | C[C@H](c1nc2ccc(Cl)cc2[nH]1)c1c(C(N)=O)cccc1C(F)(F)F |
| InChI | InChI=1S/C17H13ClF3N3O/c1-8(16-23-12-6-5-9(18)7-13(12)24-16)14-10(15(22)25)3-2-4-11(14)17(19,20)21/h2-8H,1H3,(H2,22,25)(H,23,24)/t8-/m0/s1 |
| InChIKey | MRMKMNLVAKRZLM-QMMMGPOBSA-N |
| XLogP | 4.49 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.76 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |