C28H25F9N4O2S2 — CID 154271995
4-[5-[3-fluoro-4-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butoxy]phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-7-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile (PubChem CID 154271995) has the molecular formula C28H25F9N4O2S2 and a molecular weight of 684.65 g/mol. Its IUPAC name is 4-[5-[3-fluoro-4-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butoxy]phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-7-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile.
| Compound Name | 4-[5-[3-fluoro-4-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butoxy]phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-7-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 154271995 |
| Molecular Formula | C28H25F9N4O2S2 |
| Molecular Weight | 684.65 g/mol |
| Exact Mass | 684.13 |
| IUPAC Name | 4-[5-[3-fluoro-4-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butoxy]phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-7-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1nccc(N2C(=O)C3(CCC3)N(c3ccc(OCCCCSCCCC(F)(F)C(F)(F)F)c(F)c3)C2=S)c1C(F)(F)F |
| InChI | InChI=1S/C28H25F9N4O2S2/c29-18-15-17(5-6-21(18)43-12-1-2-13-45-14-4-10-26(30,31)28(35,36)37)41-24(44)40(23(42)25(41)8-3-9-25)20-7-11-39-19(16-38)22(20)27(32,33)34/h5-7,11,15H,1-4,8-10,12-14H2 |
| InChIKey | GFZSQBLDKJGOJR-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.65 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|