C16H31NO4S — CID 154273931
2-[(4-octan-2-ylcyclohexyl)amino]-2-oxoethanesulfonic acid (PubChem CID 154273931) has the molecular formula C16H31NO4S and a molecular weight of 333.49 g/mol. Its IUPAC name is 2-[(4-octan-2-ylcyclohexyl)amino]-2-oxoethanesulfonic acid.
| Compound Name | 2-[(4-octan-2-ylcyclohexyl)amino]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 154273931 |
| Molecular Formula | C16H31NO4S |
| Molecular Weight | 333.49 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 2-[(4-octan-2-ylcyclohexyl)amino]-2-oxoethanesulfonic acid |
| SMILES | CCCCCCC(C)C1CCC(NC(=O)CS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C16H31NO4S/c1-3-4-5-6-7-13(2)14-8-10-15(11-9-14)17-16(18)12-22(19,20)21/h13-15H,3-12H2,1-2H3,(H,17,18)(H,19,20,21) |
| InChIKey | FQEWMFMYTIMHAN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|