C18H19Cl2NO — CID 154280821
4-[2-(3,4-dichlorophenoxy)phenyl]-1-methylpiperidine (PubChem CID 154280821) has the molecular formula C18H19Cl2NO and a molecular weight of 336.26 g/mol. Its IUPAC name is 4-[2-(3,4-dichlorophenoxy)phenyl]-1-methylpiperidine.
| Compound Name | 4-[2-(3,4-dichlorophenoxy)phenyl]-1-methylpiperidine |
|---|---|
| PubChem CID | 154280821 |
| Molecular Formula | C18H19Cl2NO |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 4-[2-(3,4-dichlorophenoxy)phenyl]-1-methylpiperidine |
| SMILES | CN1CCC(c2ccccc2Oc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H19Cl2NO/c1-21-10-8-13(9-11-21)15-4-2-3-5-18(15)22-14-6-7-16(19)17(20)12-14/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | CEOUJQRISARRMI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |