C30H35FN2O2 — CID 161029800
4-[2-(4-fluorophenoxy)phenyl]-1-methylpiperidine;phenyl(piperidin-4-yl)methanone (PubChem CID 161029800) has the molecular formula C30H35FN2O2 and a molecular weight of 474.62 g/mol. Its IUPAC name is 4-[2-(4-fluorophenoxy)phenyl]-1-methylpiperidine;phenyl(piperidin-4-yl)methanone.
| Compound Name | 4-[2-(4-fluorophenoxy)phenyl]-1-methylpiperidine;phenyl(piperidin-4-yl)methanone |
|---|---|
| PubChem CID | 161029800 |
| Molecular Formula | C30H35FN2O2 |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | 4-[2-(4-fluorophenoxy)phenyl]-1-methylpiperidine;phenyl(piperidin-4-yl)methanone |
| SMILES | CN1CCC(c2ccccc2Oc2ccc(F)cc2)CC1.O=C(c1ccccc1)C1CCNCC1 |
| InChI | InChI=1S/C18H20FNO.C12H15NO/c1-20-12-10-14(11-13-20)17-4-2-3-5-18(17)21-16-8-6-15(19)7-9-16;14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11/h2-9,14H,10-13H2,1H3;1-5,11,13H,6-9H2 |
| InChIKey | TZLNHCFIKFPVOD-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |