C20H31NO2 — CID 154282157
(8R,9S,10R,13S,14R,17S)-15-(aminomethyl)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 154282157) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is (8R,9S,10R,13S,14R,17S)-15-(aminomethyl)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14R,17S)-15-(aminomethyl)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 154282157 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | (8R,9S,10R,13S,14R,17S)-15-(aminomethyl)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1C(CN)C[C@@H]2O |
| InChI | InChI=1S/C20H31NO2/c1-19-7-5-14(22)10-13(19)3-4-15-16(19)6-8-20(2)17(23)9-12(11-21)18(15)20/h10,12,15-18,23H,3-9,11,21H2,1-2H3/t12?,15-,16+,17+,18+,19+,20-/m1/s1 |
| InChIKey | WFNBFOVRRWURND-UFQCMFJCSA-N |
| XLogP | 3.06 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |