C22H32O4 — CID 173448891
2-[(8R,9S,10R,13S,14R,17S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-15-yl]propanoic acid (PubChem CID 173448891) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is 2-[(8R,9S,10R,13S,14R,17S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-15-yl]propanoic acid.
| Compound Name | 2-[(8R,9S,10R,13S,14R,17S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-15-yl]propanoic acid |
|---|---|
| PubChem CID | 173448891 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 2-[(8R,9S,10R,13S,14R,17S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-15-yl]propanoic acid |
| SMILES | CC(C(=O)O)C1C[C@H](O)[C@@]2(C)CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@H]12 |
| InChI | InChI=1S/C22H32O4/c1-12(20(25)26)16-11-18(24)22(3)9-7-17-15(19(16)22)5-4-13-10-14(23)6-8-21(13,17)2/h10,12,15-19,24H,4-9,11H2,1-3H3,(H,25,26)/t12?,15-,16?,17+,18+,19-,21+,22-/m1/s1 |
| InChIKey | YLKUVGDCRPVANR-QWIVCERESA-N |
| XLogP | 3.83 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |