C31H52O3 — CID 154299138
[(3S,6R)-6-[(6R,8S,9S,10R,13R,14S,17R)-6-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-propan-2-ylhept-4-enyl] acetate (PubChem CID 154299138) has the molecular formula C31H52O3 and a molecular weight of 472.75 g/mol. Its IUPAC name is [(3S,6R)-6-[(6R,8S,9S,10R,13R,14S,17R)-6-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-propan-2-ylhept-4-enyl] acetate.
| Compound Name | [(3S,6R)-6-[(6R,8S,9S,10R,13R,14S,17R)-6-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-propan-2-ylhept-4-enyl] acetate |
|---|---|
| PubChem CID | 154299138 |
| Molecular Formula | C31H52O3 |
| Molecular Weight | 472.75 g/mol |
| Exact Mass | 472.39 |
| IUPAC Name | [(3S,6R)-6-[(6R,8S,9S,10R,13R,14S,17R)-6-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-propan-2-ylhept-4-enyl] acetate |
| SMILES | CC(=O)OCC[C@H](C=C[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C[C@@H](O)C4CCCC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| InChI | InChI=1S/C31H52O3/c1-20(2)23(15-18-34-22(4)32)11-10-21(3)25-12-13-26-24-19-29(33)28-9-7-8-16-30(28,5)27(24)14-17-31(25,26)6/h10-11,20-21,23-29,33H,7-9,12-19H2,1-6H3/t21-,23+,24+,25-,26+,27+,28?,29-,30-,31-/m1/s1 |
| InChIKey | IGHYMZODSXUJGZ-OSIJLDARSA-N |
| XLogP | 7.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.75 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|