C30H50O2 — CID 163046349
[(1S,3aR,3bS,5aR,6R,8aS,8bS,10aR)-6-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3a,5a-dimethyl-1,2,3,3b,4,5,6,7,8,8a,8b,9,10,10a-tetradecahydroindeno[5,4-e]inden-1-yl]methyl acetate (PubChem CID 163046349) has the molecular formula C30H50O2 and a molecular weight of 442.73 g/mol. Its IUPAC name is [(1S,3aR,3bS,5aR,6R,8aS,8bS,10aR)-6-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3a,5a-dimethyl-1,2,3,3b,4,5,6,7,8,8a,8b,9,10,10a-tetradecahydroindeno[5,4-e]inden-1-yl]methyl acetate.
| Compound Name | [(1S,3aR,3bS,5aR,6R,8aS,8bS,10aR)-6-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3a,5a-dimethyl-1,2,3,3b,4,5,6,7,8,8a,8b,9,10,10a-tetradecahydroindeno[5,4-e]inden-1-yl]methyl acetate |
|---|---|
| PubChem CID | 163046349 |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | [(1S,3aR,3bS,5aR,6R,8aS,8bS,10aR)-6-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3a,5a-dimethyl-1,2,3,3b,4,5,6,7,8,8a,8b,9,10,10a-tetradecahydroindeno[5,4-e]inden-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1CC[C@@]2(C)[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)/C=C/[C@H](C)C(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C30H50O2/c1-19(2)20(3)8-9-21(4)25-12-13-27-24-10-11-26-23(18-32-22(5)31)14-16-30(26,7)28(24)15-17-29(25,27)6/h8-9,19-21,23-28H,10-18H2,1-7H3/b9-8+/t20-,21+,23+,24-,25+,26+,27-,28-,29+,30-/m0/s1 |
| InChIKey | FKPWBLPQJCETBX-DXUKAOQFSA-N |
| XLogP | 7.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|