C28H48O — CID 23425061
[(1S,3aR,5aR,10aS)-6-[(Z,2R)-5,6-dimethylhept-3-en-2-yl]-3a,5a-dimethyl-1,2,3,3b,4,5,6,7,8,8a,8b,9,10,10a-tetradecahydroindeno[5,4-e]inden-1-yl]methanol (PubChem CID 23425061) has the molecular formula C28H48O and a molecular weight of 400.69 g/mol. Its IUPAC name is [(1S,3aR,5aR,10aS)-6-[(Z,2R)-5,6-dimethylhept-3-en-2-yl]-3a,5a-dimethyl-1,2,3,3b,4,5,6,7,8,8a,8b,9,10,10a-tetradecahydroindeno[5,4-e]inden-1-yl]methanol.
| Compound Name | [(1S,3aR,5aR,10aS)-6-[(Z,2R)-5,6-dimethylhept-3-en-2-yl]-3a,5a-dimethyl-1,2,3,3b,4,5,6,7,8,8a,8b,9,10,10a-tetradecahydroindeno[5,4-e]inden-1-yl]methanol |
|---|---|
| PubChem CID | 23425061 |
| Molecular Formula | C28H48O |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 400.37 |
| IUPAC Name | [(1S,3aR,5aR,10aS)-6-[(Z,2R)-5,6-dimethylhept-3-en-2-yl]-3a,5a-dimethyl-1,2,3,3b,4,5,6,7,8,8a,8b,9,10,10a-tetradecahydroindeno[5,4-e]inden-1-yl]methanol |
| SMILES | CC(C)C(C)/C=C\[C@@H](C)C1CCC2C3CC[C@H]4[C@@H](CO)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C28H48O/c1-18(2)19(3)7-8-20(4)23-11-12-25-22-9-10-24-21(17-29)13-15-28(24,6)26(22)14-16-27(23,25)5/h7-8,18-26,29H,9-17H2,1-6H3/b8-7-/t19?,20-,21-,22?,23?,24+,25?,26?,27-,28+/m1/s1 |
| InChIKey | RKYSZGJUFBBPTD-XSHWDURHSA-N |
| XLogP | 7.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|