C11H7Cl4NO4 — CID 154303110
2-chloro-5-[(4,4,4-trichloro-3-hydroxybut-2-enoyl)amino]benzoic acid (PubChem CID 154303110) has the molecular formula C11H7Cl4NO4 and a molecular weight of 358.99 g/mol. Its IUPAC name is 2-chloro-5-[(4,4,4-trichloro-3-hydroxybut-2-enoyl)amino]benzoic acid.
| Compound Name | 2-chloro-5-[(4,4,4-trichloro-3-hydroxybut-2-enoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 154303110 |
| Molecular Formula | C11H7Cl4NO4 |
| Molecular Weight | 358.99 g/mol |
| Exact Mass | 356.91 |
| IUPAC Name | 2-chloro-5-[(4,4,4-trichloro-3-hydroxybut-2-enoyl)amino]benzoic acid |
| SMILES | O=C(C=C(O)C(Cl)(Cl)Cl)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H7Cl4NO4/c12-7-2-1-5(3-6(7)10(19)20)16-9(18)4-8(17)11(13,14)15/h1-4,17H,(H,16,18)(H,19,20) |
| InChIKey | CMPQELCIFQQZRI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.99 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|