C16H11ClN2O3 — CID 154306811
6-(4-chlorophenyl)-3-(4-methylphenyl)-1,3,5-oxadiazine-2,4-dione (PubChem CID 154306811) has the molecular formula C16H11ClN2O3 and a molecular weight of 314.73 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-(4-methylphenyl)-1,3,5-oxadiazine-2,4-dione.
| Compound Name | 6-(4-chlorophenyl)-3-(4-methylphenyl)-1,3,5-oxadiazine-2,4-dione |
|---|---|
| PubChem CID | 154306811 |
| Molecular Formula | C16H11ClN2O3 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 6-(4-chlorophenyl)-3-(4-methylphenyl)-1,3,5-oxadiazine-2,4-dione |
| SMILES | Cc1ccc(-n2c(=O)nc(-c3ccc(Cl)cc3)oc2=O)cc1 |
| InChI | InChI=1S/C16H11ClN2O3/c1-10-2-8-13(9-3-10)19-15(20)18-14(22-16(19)21)11-4-6-12(17)7-5-11/h2-9H,1H3 |
| InChIKey | WURVOHNDGGGVRS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |