About ethyl 2-bromo-3H-1,3-thiazole-2-carboxylate
ethyl 2-bromo-3H-1,3-thiazole-2-carboxylate (PubChem CID 154310657) has the molecular formula C6H8BrNO2S
and a molecular weight of 238.11 g/mol. Its IUPAC name is ethyl 2-bromo-3H-1,3-thiazole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-bromo-3H-1,3-thiazole-2-carboxylate |
| PubChem CID | 154310657 |
| Molecular Formula | C6H8BrNO2S |
| Molecular Weight | 238.11 g/mol |
| Exact Mass | 236.95 |
| IUPAC Name | ethyl 2-bromo-3H-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)C1(Br)NC=CS1 |
| InChI | InChI=1S/C6H8BrNO2S/c1-2-10-5(9)6(7)8-3-4-11-6/h3-4,8H,2H2,1H3 |
| InChIKey | RQGYJAYXXOCXHN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.11 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-bromo-3H-1,3-thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-bromo-3H-1,3-thiazole-2-carboxylate?
The IUPAC name of ethyl 2-bromo-3H-1,3-thiazole-2-carboxylate (CID 154310657) is ethyl 2-bromo-3H-1,3-thiazole-2-carboxylate.
What is the SMILES notation for ethyl 2-bromo-3H-1,3-thiazole-2-carboxylate?
The canonical SMILES for ethyl 2-bromo-3H-1,3-thiazole-2-carboxylate is CCOC(=O)C1(Br)NC=CS1.
What is the InChIKey of ethyl 2-bromo-3H-1,3-thiazole-2-carboxylate?
The InChIKey is RQGYJAYXXOCXHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BrNO2S/c1-2-10-5(9)6(7)8-3-4-11-6/h3-4,8H,2H2,1H3.
What are the key properties of ethyl 2-bromo-3H-1,3-thiazole-2-carboxylate?
ethyl 2-bromo-3H-1,3-thiazole-2-carboxylate has a molecular weight of 238.11 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-bromo-3H-1,3-thiazole-2-carboxylate is sourced from PubChem (CID 154310657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).