C28H35F3N3O4Si- — CID 154318855
4-phenyl-4-[[6-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-4-yl]methoxymethyl]piperidine-1-carboxylate (PubChem CID 154318855) has the molecular formula C28H35F3N3O4Si- and a molecular weight of 562.69 g/mol. Its IUPAC name is 4-phenyl-4-[[6-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-4-yl]methoxymethyl]piperidine-1-carboxylate.
| Compound Name | 4-phenyl-4-[[6-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-4-yl]methoxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 154318855 |
| Molecular Formula | C28H35F3N3O4Si- |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | 4-phenyl-4-[[6-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-4-yl]methoxymethyl]piperidine-1-carboxylate |
| SMILES | C[Si](C)(C)CCOCn1cnc2c(COCC3(c4ccccc4)CCN(C(=O)[O-])CC3)cc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C28H36F3N3O4Si/c1-39(2,3)14-13-37-20-34-19-32-25-21(15-23(16-24(25)34)28(29,30)31)17-38-18-27(22-7-5-4-6-8-22)9-11-33(12-10-27)26(35)36/h4-8,15-16,19H,9-14,17-18,20H2,1-3H3,(H,35,36)/p-1 |
| InChIKey | JTEAIOHZYOVJNO-UHFFFAOYSA-M |
| XLogP | 5.26 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|